C30H37F3N2O3 — CID 169061049
4-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid (PubChem CID 169061049) has the molecular formula C30H37F3N2O3 and a molecular weight of 530.63 g/mol. Its IUPAC name is 4-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid.
| Compound Name | 4-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 169061049 |
| Molecular Formula | C30H37F3N2O3 |
| Molecular Weight | 530.63 g/mol |
| Exact Mass | 530.28 |
| IUPAC Name | 4-[[5-[(E)-N-[[4-cyclohexyl-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid |
| SMILES | C/C(=N\OCc1ccc(C2CCCCC2)c(C(F)(F)F)c1)c1cccc2c1CCCC2NCCCC(=O)O |
| InChI | InChI=1S/C30H37F3N2O3/c1-20(23-10-5-12-26-25(23)11-6-13-28(26)34-17-7-14-29(36)37)35-38-19-21-15-16-24(22-8-3-2-4-9-22)27(18-21)30(31,32)33/h5,10,12,15-16,18,22,28,34H,2-4,6-9,11,13-14,17,19H2,1H3,(H,36,37)/b35-20+ |
| InChIKey | MJTUTBSYZYVRQW-JEPNHJGPSA-N |
| XLogP | 7.53 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.63 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|