C29H35F3N2O4 — CID 169061126
4-[[5-[(E)-N-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid (PubChem CID 169061126) has the molecular formula C29H35F3N2O4 and a molecular weight of 532.60 g/mol. Its IUPAC name is 4-[[5-[(E)-N-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid.
| Compound Name | 4-[[5-[(E)-N-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 169061126 |
| Molecular Formula | C29H35F3N2O4 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.25 |
| IUPAC Name | 4-[[5-[(E)-N-[[4-cyclopentyloxy-3-(trifluoromethyl)phenyl]methoxy]-C-methylcarbonimidoyl]-1,2,3,4-tetrahydronaphthalen-1-yl]amino]butanoic acid |
| SMILES | C/C(=N\OCc1ccc(OC2CCCC2)c(C(F)(F)F)c1)c1cccc2c1CCCC2NCCCC(=O)O |
| InChI | InChI=1S/C29H35F3N2O4/c1-19(22-9-4-11-24-23(22)10-5-12-26(24)33-16-6-13-28(35)36)34-37-18-20-14-15-27(25(17-20)29(30,31)32)38-21-7-2-3-8-21/h4,9,11,14-15,17,21,26,33H,2-3,5-8,10,12-13,16,18H2,1H3,(H,35,36)/b34-19+ |
| InChIKey | ZACGWUJOQLWPDR-ALQBTCKLSA-N |
| XLogP | 6.80 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|