C29H66N10O4 — CID 140961640
5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethoxy]-2-ethyl-4,4-dimethyl-5-oxopentanoic acid (PubChem CID 140961640) has the molecular formula C29H66N10O4 and a molecular weight of 618.91 g/mol. Its IUPAC name is 5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethoxy]-2-ethyl-4,4-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethoxy]-2-ethyl-4,4-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 140961640 |
| Molecular Formula | C29H66N10O4 |
| Molecular Weight | 618.91 g/mol |
| Exact Mass | 618.53 |
| IUPAC Name | 5-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethylamino]ethoxy]-2-ethyl-4,4-dimethyl-5-oxopentanoic acid |
| SMILES | CCC(CC(C)(C)C(=O)OCCNCCNCCNCCNCCNCCNCCNCCNCCNCCN)C(=O)O |
| InChI | InChI=1S/C29H66N10O4/c1-4-26(27(40)41)25-29(2,3)28(42)43-24-23-39-22-21-38-20-19-37-18-17-36-16-15-35-14-13-34-12-11-33-10-9-32-8-7-31-6-5-30/h26,31-39H,4-25,30H2,1-3H3,(H,40,41) |
| InChIKey | WLSJNKGJARQTDV-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 197.89 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.91 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|