About N-butylbutan-1-amine;2-ethylhexanoic acid
N-butylbutan-1-amine;2-ethylhexanoic acid (PubChem CID 22182206) has the molecular formula C16H35NO2
and a molecular weight of 273.46 g/mol. Its IUPAC name is N-butylbutan-1-amine;2-ethylhexanoic acid.
Molecular Properties
| Compound Name | N-butylbutan-1-amine;2-ethylhexanoic acid |
| PubChem CID | 22182206 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | N-butylbutan-1-amine;2-ethylhexanoic acid |
| SMILES | CCCCC(CC)C(=O)O.CCCCNCCCC |
| InChI | InChI=1S/C8H19N.C8H16O2/c1-3-5-7-9-8-6-4-2;1-3-5-6-7(4-2)8(9)10/h9H,3-8H2,1-2H3;7H,3-6H2,1-2H3,(H,9,10) |
| InChIKey | WPGMTMBMSSRPKH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylbutan-1-amine;2-ethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylbutan-1-amine;2-ethylhexanoic acid?
The IUPAC name of N-butylbutan-1-amine;2-ethylhexanoic acid (CID 22182206) is N-butylbutan-1-amine;2-ethylhexanoic acid.
What is the SMILES notation for N-butylbutan-1-amine;2-ethylhexanoic acid?
The canonical SMILES for N-butylbutan-1-amine;2-ethylhexanoic acid is CCCCC(CC)C(=O)O.CCCCNCCCC.
What is the InChIKey of N-butylbutan-1-amine;2-ethylhexanoic acid?
The InChIKey is WPGMTMBMSSRPKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N.C8H16O2/c1-3-5-7-9-8-6-4-2;1-3-5-6-7(4-2)8(9)10/h9H,3-8H2,1-2H3;7H,3-6H2,1-2H3,(H,9,10).
What are the key properties of N-butylbutan-1-amine;2-ethylhexanoic acid?
N-butylbutan-1-amine;2-ethylhexanoic acid has a molecular weight of 273.46 g/mol, XLogP of 4.46, 11 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylbutan-1-amine;2-ethylhexanoic acid is sourced from PubChem (CID 22182206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).