About 6-amino-2-ethylhexanoic acid;azane
6-amino-2-ethylhexanoic acid;azane (PubChem CID 88821488) has the molecular formula C8H20N2O2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 6-amino-2-ethylhexanoic acid;azane.
Molecular Properties
| Compound Name | 6-amino-2-ethylhexanoic acid;azane |
| PubChem CID | 88821488 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 6-amino-2-ethylhexanoic acid;azane |
| SMILES | CCC(CCCCN)C(=O)O.N |
| InChI | InChI=1S/C8H17NO2.H3N/c1-2-7(8(10)11)5-3-4-6-9;/h7H,2-6,9H2,1H3,(H,10,11);1H3 |
| InChIKey | SEQPQBQXJJBXDO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-2-ethylhexanoic acid;azane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-ethylhexanoic acid;azane?
The IUPAC name of 6-amino-2-ethylhexanoic acid;azane (CID 88821488) is 6-amino-2-ethylhexanoic acid;azane.
What is the SMILES notation for 6-amino-2-ethylhexanoic acid;azane?
The canonical SMILES for 6-amino-2-ethylhexanoic acid;azane is CCC(CCCCN)C(=O)O.N.
What is the InChIKey of 6-amino-2-ethylhexanoic acid;azane?
The InChIKey is SEQPQBQXJJBXDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.H3N/c1-2-7(8(10)11)5-3-4-6-9;/h7H,2-6,9H2,1H3,(H,10,11);1H3.
What are the key properties of 6-amino-2-ethylhexanoic acid;azane?
6-amino-2-ethylhexanoic acid;azane has a molecular weight of 176.26 g/mol, XLogP of 1.39, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-ethylhexanoic acid;azane is sourced from PubChem (CID 88821488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).