C7H18NO+ — CID 140963975
[(2R)-1-hydroxy-4,4-dimethylpentan-2-yl]azanium (PubChem CID 140963975) has the molecular formula C7H18NO+ and a molecular weight of 132.23 g/mol. Its IUPAC name is [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl]azanium.
| Compound Name | [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl]azanium |
|---|---|
| PubChem CID | 140963975 |
| Molecular Formula | C7H18NO+ |
| Molecular Weight | 132.23 g/mol |
| Exact Mass | 132.14 |
| IUPAC Name | [(2R)-1-hydroxy-4,4-dimethylpentan-2-yl]azanium |
| SMILES | CC(C)(C)C[C@@H]([NH3+])CO |
| InChI | InChI=1S/C7H17NO/c1-7(2,3)4-6(8)5-9/h6,9H,4-5,8H2,1-3H3/p+1/t6-/m1/s1 |
| InChIKey | OCJXWXGVDQCFJW-ZCFIWIBFSA-O |
| XLogP | 0.03 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |