C31H35N5O — CID 140965510
1-[1-[[4-[(3R,3aR,5R,6aR)-3-(cyclopropylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]phenyl]methyl]indol-5-yl]-5-methylpyrazole-3-carboxamide (PubChem CID 140965510) has the molecular formula C31H35N5O and a molecular weight of 493.66 g/mol. Its IUPAC name is 1-[1-[[4-[(3R,3aR,5R,6aR)-3-(cyclopropylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]phenyl]methyl]indol-5-yl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 1-[1-[[4-[(3R,3aR,5R,6aR)-3-(cyclopropylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]phenyl]methyl]indol-5-yl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 140965510 |
| Molecular Formula | C31H35N5O |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | 1-[1-[[4-[(3R,3aR,5R,6aR)-3-(cyclopropylmethyl)-1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-5-yl]phenyl]methyl]indol-5-yl]-5-methylpyrazole-3-carboxamide |
| SMILES | Cc1cc(C(N)=O)nn1-c1ccc2c(ccn2Cc2ccc([C@@H]3C[C@H]4CN[C@H](CC5CC5)[C@@H]4C3)cc2)c1 |
| InChI | InChI=1S/C31H35N5O/c1-19-12-29(31(32)37)34-36(19)26-8-9-30-23(15-26)10-11-35(30)18-21-4-6-22(7-5-21)24-14-25-17-33-28(27(25)16-24)13-20-2-3-20/h4-12,15,20,24-25,27-28,33H,2-3,13-14,16-18H2,1H3,(H2,32,37)/t24-,25+,27-,28-/m1/s1 |
| InChIKey | XXNCVSOLNNYCQS-QEFMBMMRSA-N |
| XLogP | 5.16 |
| TPSA | 77.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |