C19H13O7-3 — CID 140965650
2-[3-[3,5-bis(carboxylatomethyl)benzoyl]phenyl]acetate (PubChem CID 140965650) has the molecular formula C19H13O7-3 and a molecular weight of 353.31 g/mol. Its IUPAC name is 2-[3-[3,5-bis(carboxylatomethyl)benzoyl]phenyl]acetate.
| Compound Name | 2-[3-[3,5-bis(carboxylatomethyl)benzoyl]phenyl]acetate |
|---|---|
| PubChem CID | 140965650 |
| Molecular Formula | C19H13O7-3 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | 2-[3-[3,5-bis(carboxylatomethyl)benzoyl]phenyl]acetate |
| SMILES | O=C([O-])Cc1cccc(C(=O)c2cc(CC(=O)[O-])cc(CC(=O)[O-])c2)c1 |
| InChI | InChI=1S/C19H16O7/c20-16(21)8-11-2-1-3-14(5-11)19(26)15-6-12(9-17(22)23)4-13(7-15)10-18(24)25/h1-7H,8-10H2,(H,20,21)(H,22,23)(H,24,25)/p-3 |
| InChIKey | RSPKXQMDQFXIPR-UHFFFAOYSA-K |
| XLogP | -2.21 |
| TPSA | 137.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |