C14H23N — CID 140967568
4-hexyl-4,5,6,7-tetrahydro-2H-indole (PubChem CID 140967568) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is 4-hexyl-4,5,6,7-tetrahydro-2H-indole.
| Compound Name | 4-hexyl-4,5,6,7-tetrahydro-2H-indole |
|---|---|
| PubChem CID | 140967568 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | 4-hexyl-4,5,6,7-tetrahydro-2H-indole |
| SMILES | CCCCCCC1CCCC2=NCC=C21 |
| InChI | InChI=1S/C14H23N/c1-2-3-4-5-7-12-8-6-9-14-13(12)10-11-15-14/h10,12H,2-9,11H2,1H3 |
| InChIKey | VVIRJVBRIOEYPF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|