C10H11FO — CID 140969413
5-fluoro-3,4,4a,5-tetrahydro-2H-naphthalen-1-one (PubChem CID 140969413) has the molecular formula C10H11FO and a molecular weight of 166.20 g/mol. Its IUPAC name is 5-fluoro-3,4,4a,5-tetrahydro-2H-naphthalen-1-one.
| Compound Name | 5-fluoro-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 140969413 |
| Molecular Formula | C10H11FO |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 5-fluoro-3,4,4a,5-tetrahydro-2H-naphthalen-1-one |
| SMILES | O=C1CCCC2C1=CC=CC2F |
| InChI | InChI=1S/C10H11FO/c11-9-5-1-4-8-7(9)3-2-6-10(8)12/h1,4-5,7,9H,2-3,6H2 |
| InChIKey | BRBMTRKUMDGFIB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |