C18H26N2O3 — CID 140969557
3-[4-(N-acetyl-2,4-dimethylanilino)piperidin-1-yl]propanoic acid (PubChem CID 140969557) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 3-[4-(N-acetyl-2,4-dimethylanilino)piperidin-1-yl]propanoic acid.
| Compound Name | 3-[4-(N-acetyl-2,4-dimethylanilino)piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 140969557 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 3-[4-(N-acetyl-2,4-dimethylanilino)piperidin-1-yl]propanoic acid |
| SMILES | CC(=O)N(c1ccc(C)cc1C)C1CCN(CCC(=O)O)CC1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-4-5-17(14(2)12-13)20(15(3)21)16-6-9-19(10-7-16)11-8-18(22)23/h4-5,12,16H,6-11H2,1-3H3,(H,22,23) |
| InChIKey | VOLSHVCZBZDOHW-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |