C17H24N2O2 — CID 140969567
N-(1-acetylpiperidin-4-yl)-N-(2,4-dimethylphenyl)acetamide (PubChem CID 140969567) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is N-(1-acetylpiperidin-4-yl)-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | N-(1-acetylpiperidin-4-yl)-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 140969567 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | N-(1-acetylpiperidin-4-yl)-N-(2,4-dimethylphenyl)acetamide |
| SMILES | CC(=O)N1CCC(N(C(C)=O)c2ccc(C)cc2C)CC1 |
| InChI | InChI=1S/C17H24N2O2/c1-12-5-6-17(13(2)11-12)19(15(4)21)16-7-9-18(10-8-16)14(3)20/h5-6,11,16H,7-10H2,1-4H3 |
| InChIKey | OZCGXBHSULYGSR-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |