C24H16N2OS — CID 140970255
4-(furan-2-yl)-1-(1H-indol-2-yl)-3-thiophen-2-yl-2H-isoindole (PubChem CID 140970255) has the molecular formula C24H16N2OS and a molecular weight of 380.47 g/mol. Its IUPAC name is 4-(furan-2-yl)-1-(1H-indol-2-yl)-3-thiophen-2-yl-2H-isoindole.
| Compound Name | 4-(furan-2-yl)-1-(1H-indol-2-yl)-3-thiophen-2-yl-2H-isoindole |
|---|---|
| PubChem CID | 140970255 |
| Molecular Formula | C24H16N2OS |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4-(furan-2-yl)-1-(1H-indol-2-yl)-3-thiophen-2-yl-2H-isoindole |
| SMILES | c1coc(-c2cccc3c(-c4cc5ccccc5[nH]4)[nH]c(-c4cccs4)c23)c1 |
| InChI | InChI=1S/C24H16N2OS/c1-2-9-18-15(6-1)14-19(25-18)23-17-8-3-7-16(20-10-4-12-27-20)22(17)24(26-23)21-11-5-13-28-21/h1-14,25-26H |
| InChIKey | UIIMBBGMSSSNQF-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 44.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |