About ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate
ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate (PubChem CID 140970368) has the molecular formula C24H19NO4
and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate |
| PubChem CID | 140970368 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc3c(c2)OCO3)c2ccc[nH]c-2c1-c1ccccc1 |
| InChI | InChI=1S/C24H19NO4/c1-2-27-24(26)22-20(16-10-11-18-19(13-16)29-14-28-18)17-9-6-12-25-23(17)21(22)15-7-4-3-5-8-15/h3-13,25H,2,14H2,1H3 |
| InChIKey | XVYDEJWXQLTSSS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate?
The IUPAC name of ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate (CID 140970368) is ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate.
What is the SMILES notation for ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate?
The canonical SMILES for ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate is CCOC(=O)c1c(-c2ccc3c(c2)OCO3)c2ccc[nH]c-2c1-c1ccccc1.
What is the InChIKey of ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate?
The InChIKey is XVYDEJWXQLTSSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19NO4/c1-2-27-24(26)22-20(16-10-11-18-19(13-16)29-14-28-18)17-9-6-12-25-23(17)21(22)15-7-4-3-5-8-15/h3-13,25H,2,14H2,1H3.
What are the key properties of ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate?
ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate has a molecular weight of 385.42 g/mol, XLogP of 5.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(1,3-benzodioxol-5-yl)-7-phenyl-1H-cyclopenta[b]pyridine-6-carboxylate is sourced from PubChem (CID 140970368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).