C32H40N2O5 — CID 140970992
benzyl N-[4-[2-[2-[4-(phenylmethoxycarbonylamino)cyclohexylidene]ethoxy]ethylidene]cyclohexyl]carbamate (PubChem CID 140970992) has the molecular formula C32H40N2O5 and a molecular weight of 532.68 g/mol. Its IUPAC name is benzyl N-[4-[2-[2-[4-(phenylmethoxycarbonylamino)cyclohexylidene]ethoxy]ethylidene]cyclohexyl]carbamate.
| Compound Name | benzyl N-[4-[2-[2-[4-(phenylmethoxycarbonylamino)cyclohexylidene]ethoxy]ethylidene]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 140970992 |
| Molecular Formula | C32H40N2O5 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | benzyl N-[4-[2-[2-[4-(phenylmethoxycarbonylamino)cyclohexylidene]ethoxy]ethylidene]cyclohexyl]carbamate |
| SMILES | O=C(NC1CCC(=CCOCC=C2CCC(NC(=O)OCc3ccccc3)CC2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C32H40N2O5/c35-31(38-23-27-7-3-1-4-8-27)33-29-15-11-25(12-16-29)19-21-37-22-20-26-13-17-30(18-14-26)34-32(36)39-24-28-9-5-2-6-10-28/h1-10,19-20,29-30H,11-18,21-24H2,(H,33,35)(H,34,36)/b25-19-,26-20- |
| InChIKey | MFMCVCSGQNYWRO-DQIQZUARSA-N |
| XLogP | 6.59 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|