C21H26O5 — CID 140971437
(2R)-2-[(2,4-dimethoxyphenyl)methyl]-2-hydroxy-6-phenylhexanoic acid (PubChem CID 140971437) has the molecular formula C21H26O5 and a molecular weight of 358.43 g/mol. Its IUPAC name is (2R)-2-[(2,4-dimethoxyphenyl)methyl]-2-hydroxy-6-phenylhexanoic acid.
| Compound Name | (2R)-2-[(2,4-dimethoxyphenyl)methyl]-2-hydroxy-6-phenylhexanoic acid |
|---|---|
| PubChem CID | 140971437 |
| Molecular Formula | C21H26O5 |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (2R)-2-[(2,4-dimethoxyphenyl)methyl]-2-hydroxy-6-phenylhexanoic acid |
| SMILES | COc1ccc(C[C@](O)(CCCCc2ccccc2)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C21H26O5/c1-25-18-12-11-17(19(14-18)26-2)15-21(24,20(22)23)13-7-6-10-16-8-4-3-5-9-16/h3-5,8-9,11-12,14,24H,6-7,10,13,15H2,1-2H3,(H,22,23)/t21-/m1/s1 |
| InChIKey | HUGYWLCKBCAQIW-OAQYLSRUSA-N |
| XLogP | 3.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|