C22H28O4 — CID 150251513
2-hydroxy-2-[3-(4-methoxyphenyl)propyl]-4-methyl-4-phenylpentanoic acid (PubChem CID 150251513) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is 2-hydroxy-2-[3-(4-methoxyphenyl)propyl]-4-methyl-4-phenylpentanoic acid.
| Compound Name | 2-hydroxy-2-[3-(4-methoxyphenyl)propyl]-4-methyl-4-phenylpentanoic acid |
|---|---|
| PubChem CID | 150251513 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-hydroxy-2-[3-(4-methoxyphenyl)propyl]-4-methyl-4-phenylpentanoic acid |
| SMILES | COc1ccc(CCCC(O)(CC(C)(C)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H28O4/c1-21(2,18-9-5-4-6-10-18)16-22(25,20(23)24)15-7-8-17-11-13-19(26-3)14-12-17/h4-6,9-14,25H,7-8,15-16H2,1-3H3,(H,23,24) |
| InChIKey | FZQRTCUWHMIUCM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |