C23H24O3 — CID 22284895
2-hydroxy-4-methyl-2-(naphthalen-2-ylmethyl)-4-phenylpentanoic acid (PubChem CID 22284895) has the molecular formula C23H24O3 and a molecular weight of 348.44 g/mol. Its IUPAC name is 2-hydroxy-4-methyl-2-(naphthalen-2-ylmethyl)-4-phenylpentanoic acid.
| Compound Name | 2-hydroxy-4-methyl-2-(naphthalen-2-ylmethyl)-4-phenylpentanoic acid |
|---|---|
| PubChem CID | 22284895 |
| Molecular Formula | C23H24O3 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-hydroxy-4-methyl-2-(naphthalen-2-ylmethyl)-4-phenylpentanoic acid |
| SMILES | CC(C)(CC(O)(Cc1ccc2ccccc2c1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C23H24O3/c1-22(2,20-10-4-3-5-11-20)16-23(26,21(24)25)15-17-12-13-18-8-6-7-9-19(18)14-17/h3-14,26H,15-16H2,1-2H3,(H,24,25) |
| InChIKey | YXSUMQPXXIZDRU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |