C22H27FO5 — CID 22284900
4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-2-[2-(4-methoxyphenyl)ethyl]-4-methylpentanoic acid (PubChem CID 22284900) has the molecular formula C22H27FO5 and a molecular weight of 390.45 g/mol. Its IUPAC name is 4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-2-[2-(4-methoxyphenyl)ethyl]-4-methylpentanoic acid.
| Compound Name | 4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-2-[2-(4-methoxyphenyl)ethyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22284900 |
| Molecular Formula | C22H27FO5 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-2-[2-(4-methoxyphenyl)ethyl]-4-methylpentanoic acid |
| SMILES | COc1ccc(CCC(O)(CC(C)(C)c2cc(F)ccc2OC)C(=O)O)cc1 |
| InChI | InChI=1S/C22H27FO5/c1-21(2,18-13-16(23)7-10-19(18)28-4)14-22(26,20(24)25)12-11-15-5-8-17(27-3)9-6-15/h5-10,13,26H,11-12,14H2,1-4H3,(H,24,25) |
| InChIKey | YUYXDWVICGJHLJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |