C26H34FNO3 — CID 10216611
2-(cyclohexylmethyl)-4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-N-phenylpentanamide (PubChem CID 10216611) has the molecular formula C26H34FNO3 and a molecular weight of 427.56 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-N-phenylpentanamide.
| Compound Name | 2-(cyclohexylmethyl)-4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-N-phenylpentanamide |
|---|---|
| PubChem CID | 10216611 |
| Molecular Formula | C26H34FNO3 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-(cyclohexylmethyl)-4-(5-fluoro-2-methoxyphenyl)-2-hydroxy-4-methyl-N-phenylpentanamide |
| SMILES | COc1ccc(F)cc1C(C)(C)CC(O)(CC1CCCCC1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C26H34FNO3/c1-25(2,22-16-20(27)14-15-23(22)31-3)18-26(30,17-19-10-6-4-7-11-19)24(29)28-21-12-8-5-9-13-21/h5,8-9,12-16,19,30H,4,6-7,10-11,17-18H2,1-3H3,(H,28,29) |
| InChIKey | UUGDPYMSRRRUAF-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |