C20H30O4 — CID 22284904
2-(cyclohexylmethyl)-2-hydroxy-4-(2-methoxyphenyl)-4-methylpentanoic acid (PubChem CID 22284904) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-2-hydroxy-4-(2-methoxyphenyl)-4-methylpentanoic acid.
| Compound Name | 2-(cyclohexylmethyl)-2-hydroxy-4-(2-methoxyphenyl)-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22284904 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-(cyclohexylmethyl)-2-hydroxy-4-(2-methoxyphenyl)-4-methylpentanoic acid |
| SMILES | COc1ccccc1C(C)(C)CC(O)(CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C20H30O4/c1-19(2,16-11-7-8-12-17(16)24-3)14-20(23,18(21)22)13-15-9-5-4-6-10-15/h7-8,11-12,15,23H,4-6,9-10,13-14H2,1-3H3,(H,21,22) |
| InChIKey | AVGNOKXJUPFOTJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |