C19H30O2 — CID 69420884
2-(cyclohexylmethyl)-4-methyl-4-phenylpentane-1,2-diol (PubChem CID 69420884) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-4-methyl-4-phenylpentane-1,2-diol.
| Compound Name | 2-(cyclohexylmethyl)-4-methyl-4-phenylpentane-1,2-diol |
|---|---|
| PubChem CID | 69420884 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 2-(cyclohexylmethyl)-4-methyl-4-phenylpentane-1,2-diol |
| SMILES | CC(C)(CC(O)(CO)CC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H30O2/c1-18(2,17-11-7-4-8-12-17)14-19(21,15-20)13-16-9-5-3-6-10-16/h4,7-8,11-12,16,20-21H,3,5-6,9-10,13-15H2,1-2H3 |
| InChIKey | CJFUUTLEFLJKKY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |