C13H19NO4 — CID 58820292
2-amino-2-(hydroxymethyl)-5-(4-methoxyphenyl)pentanoic acid (PubChem CID 58820292) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)-5-(4-methoxyphenyl)pentanoic acid.
| Compound Name | 2-amino-2-(hydroxymethyl)-5-(4-methoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 58820292 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)-5-(4-methoxyphenyl)pentanoic acid |
| SMILES | COc1ccc(CCCC(N)(CO)C(=O)O)cc1 |
| InChI | InChI=1S/C13H19NO4/c1-18-11-6-4-10(5-7-11)3-2-8-13(14,9-15)12(16)17/h4-7,15H,2-3,8-9,14H2,1H3,(H,16,17) |
| InChIKey | YULUKDZKNQGRQM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |