C15H23NO5 — CID 58624259
methyl 2-amino-3-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenyl)hexanoate (PubChem CID 58624259) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl 2-amino-3-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenyl)hexanoate.
| Compound Name | methyl 2-amino-3-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenyl)hexanoate |
|---|---|
| PubChem CID | 58624259 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | methyl 2-amino-3-hydroxy-2-(hydroxymethyl)-6-(4-methoxyphenyl)hexanoate |
| SMILES | COC(=O)C(N)(CO)C(O)CCCc1ccc(OC)cc1 |
| InChI | InChI=1S/C15H23NO5/c1-20-12-8-6-11(7-9-12)4-3-5-13(18)15(16,10-17)14(19)21-2/h6-9,13,17-18H,3-5,10,16H2,1-2H3 |
| InChIKey | RRHRRUWGBLLMHR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |