C9H12N2O — CID 140972419
[(2S)-pyrrolidin-2-yl]-(1H-pyrrol-2-yl)methanone (PubChem CID 140972419) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is [(2S)-pyrrolidin-2-yl]-(1H-pyrrol-2-yl)methanone.
| Compound Name | [(2S)-pyrrolidin-2-yl]-(1H-pyrrol-2-yl)methanone |
|---|---|
| PubChem CID | 140972419 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | [(2S)-pyrrolidin-2-yl]-(1H-pyrrol-2-yl)methanone |
| SMILES | O=C(c1ccc[nH]1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C9H12N2O/c12-9(7-3-1-5-10-7)8-4-2-6-11-8/h1,3,5,8,10-11H,2,4,6H2/t8-/m0/s1 |
| InChIKey | NFEUBURNIHKONI-QMMMGPOBSA-N |
| XLogP | 0.95 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |