C18H22ClNO3 — CID 140972569
2-methylhexyl 2-(5-chloroquinolin-8-yl)oxyacetate (PubChem CID 140972569) has the molecular formula C18H22ClNO3 and a molecular weight of 335.83 g/mol. Its IUPAC name is 2-methylhexyl 2-(5-chloroquinolin-8-yl)oxyacetate.
| Compound Name | 2-methylhexyl 2-(5-chloroquinolin-8-yl)oxyacetate |
|---|---|
| PubChem CID | 140972569 |
| Molecular Formula | C18H22ClNO3 |
| Molecular Weight | 335.83 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 2-methylhexyl 2-(5-chloroquinolin-8-yl)oxyacetate |
| SMILES | CCCCC(C)COC(=O)COc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C18H22ClNO3/c1-3-4-6-13(2)11-23-17(21)12-22-16-9-8-15(19)14-7-5-10-20-18(14)16/h5,7-10,13H,3-4,6,11-12H2,1-2H3 |
| InChIKey | GTTCTOVHTPKQNQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.83 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |