C18H24ClNO4 — CID 66905962
heptan-2-yl 2-(5-chloroquinolin-8-yl)oxyacetate;hydrate (PubChem CID 66905962) has the molecular formula C18H24ClNO4 and a molecular weight of 353.85 g/mol. Its IUPAC name is heptan-2-yl 2-(5-chloroquinolin-8-yl)oxyacetate;hydrate.
| Compound Name | heptan-2-yl 2-(5-chloroquinolin-8-yl)oxyacetate;hydrate |
|---|---|
| PubChem CID | 66905962 |
| Molecular Formula | C18H24ClNO4 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | heptan-2-yl 2-(5-chloroquinolin-8-yl)oxyacetate;hydrate |
| SMILES | CCCCCC(C)OC(=O)COc1ccc(Cl)c2cccnc12.O |
| InChI | InChI=1S/C18H22ClNO3.H2O/c1-3-4-5-7-13(2)23-17(21)12-22-16-10-9-15(19)14-8-6-11-20-18(14)16;/h6,8-11,13H,3-5,7,12H2,1-2H3;1H2 |
| InChIKey | OGLOQKNIRYWWSV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 79.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|