About S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate
S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate (PubChem CID 23180345) has the molecular formula C19H24ClNO2S
and a molecular weight of 365.93 g/mol. Its IUPAC name is S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate.
Molecular Properties
| Compound Name | S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate |
| PubChem CID | 23180345 |
| Molecular Formula | C19H24ClNO2S |
| Molecular Weight | 365.93 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate |
| SMILES | CCCCCCCCSC(=O)COc1ccc(Cl)c2cccnc12 |
| InChI | InChI=1S/C19H24ClNO2S/c1-2-3-4-5-6-7-13-24-18(22)14-23-17-11-10-16(20)15-9-8-12-21-19(15)17/h8-12H,2-7,13-14H2,1H3 |
| InChIKey | PNLXCHGMECKKDN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.93 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate?
The IUPAC name of S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate (CID 23180345) is S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate.
What is the SMILES notation for S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate?
The canonical SMILES for S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate is CCCCCCCCSC(=O)COc1ccc(Cl)c2cccnc12.
What is the InChIKey of S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate?
The InChIKey is PNLXCHGMECKKDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24ClNO2S/c1-2-3-4-5-6-7-13-24-18(22)14-23-17-11-10-16(20)15-9-8-12-21-19(15)17/h8-12H,2-7,13-14H2,1H3.
What are the key properties of S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate?
S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate has a molecular weight of 365.93 g/mol, XLogP of 5.89, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-octyl 2-(5-chloroquinolin-8-yl)oxyethanethioate is sourced from PubChem (CID 23180345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).