C11H20N2 — CID 140972578
(5E)-5-(1-methylpiperidin-2-ylidene)pentan-1-imine (PubChem CID 140972578) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (5E)-5-(1-methylpiperidin-2-ylidene)pentan-1-imine.
| Compound Name | (5E)-5-(1-methylpiperidin-2-ylidene)pentan-1-imine |
|---|---|
| PubChem CID | 140972578 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (5E)-5-(1-methylpiperidin-2-ylidene)pentan-1-imine |
| SMILES | [H]/N=C/CCC/C=C1\CCCCN1C |
| InChI | InChI=1S/C11H20N2/c1-13-10-6-4-8-11(13)7-3-2-5-9-12/h7,9,12H,2-6,8,10H2,1H3/b11-7+,12-9+ |
| InChIKey | KVAJTZABKIFDQM-HNWKWBPYSA-N |
| XLogP | 2.81 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|