C17H34N4 — CID 153405619
1-[(E)-5-amino-1-iminohex-4-en-2-yl]-N,N-dipropylpiperidin-4-amine (PubChem CID 153405619) has the molecular formula C17H34N4 and a molecular weight of 294.49 g/mol. Its IUPAC name is 1-[(E)-5-amino-1-iminohex-4-en-2-yl]-N,N-dipropylpiperidin-4-amine.
| Compound Name | 1-[(E)-5-amino-1-iminohex-4-en-2-yl]-N,N-dipropylpiperidin-4-amine |
|---|---|
| PubChem CID | 153405619 |
| Molecular Formula | C17H34N4 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.28 |
| IUPAC Name | 1-[(E)-5-amino-1-iminohex-4-en-2-yl]-N,N-dipropylpiperidin-4-amine |
| SMILES | [H]/N=C/C(C/C=C(\C)N)N1CCC(N(CCC)CCC)CC1 |
| InChI | InChI=1S/C17H34N4/c1-4-10-20(11-5-2)16-8-12-21(13-9-16)17(14-18)7-6-15(3)19/h6,14,16-18H,4-5,7-13,19H2,1-3H3/b15-6+,18-14+ |
| InChIKey | GHLPEQXXYWSBCM-MSBMPMNRSA-N |
| XLogP | 2.84 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|