C11H19N3 — CID 171811235
(E)-2-piperidin-1-ylhex-2-ene-1,4-diimine (PubChem CID 171811235) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is (E)-2-piperidin-1-ylhex-2-ene-1,4-diimine.
| Compound Name | (E)-2-piperidin-1-ylhex-2-ene-1,4-diimine |
|---|---|
| PubChem CID | 171811235 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (E)-2-piperidin-1-ylhex-2-ene-1,4-diimine |
| SMILES | [H]/N=C/C(=C\C(CC)=N\[H])N1CCCCC1 |
| InChI | InChI=1S/C11H19N3/c1-2-10(13)8-11(9-12)14-6-4-3-5-7-14/h8-9,12-13H,2-7H2,1H3/b11-8+,12-9+,13-10+ |
| InChIKey | BLEFUKFQOGBIKM-FOXWYSRTSA-N |
| XLogP | 2.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|