C12H22N2 — CID 140972590
(6E)-6-(1-methylpiperidin-2-ylidene)hexan-1-imine (PubChem CID 140972590) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (6E)-6-(1-methylpiperidin-2-ylidene)hexan-1-imine.
| Compound Name | (6E)-6-(1-methylpiperidin-2-ylidene)hexan-1-imine |
|---|---|
| PubChem CID | 140972590 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (6E)-6-(1-methylpiperidin-2-ylidene)hexan-1-imine |
| SMILES | [H]/N=C/CCCC/C=C1\CCCCN1C |
| InChI | InChI=1S/C12H22N2/c1-14-11-7-5-9-12(14)8-4-2-3-6-10-13/h8,10,13H,2-7,9,11H2,1H3/b12-8+,13-10+ |
| InChIKey | OIZWQLVYUAGZDU-SDCOAONHSA-N |
| XLogP | 3.20 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|