C30H45NO4 — CID 140974293
1-[(2R,5R)-5-decoxyoctan-2-yl]oxy-2-nitro-4-phenylbenzene (PubChem CID 140974293) has the molecular formula C30H45NO4 and a molecular weight of 483.69 g/mol. Its IUPAC name is 1-[(2R,5R)-5-decoxyoctan-2-yl]oxy-2-nitro-4-phenylbenzene.
| Compound Name | 1-[(2R,5R)-5-decoxyoctan-2-yl]oxy-2-nitro-4-phenylbenzene |
|---|---|
| PubChem CID | 140974293 |
| Molecular Formula | C30H45NO4 |
| Molecular Weight | 483.69 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | 1-[(2R,5R)-5-decoxyoctan-2-yl]oxy-2-nitro-4-phenylbenzene |
| SMILES | CCCCCCCCCCO[C@H](CCC)CC[C@@H](C)Oc1ccc(-c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H45NO4/c1-4-6-7-8-9-10-11-15-23-34-28(16-5-2)21-19-25(3)35-30-22-20-27(24-29(30)31(32)33)26-17-13-12-14-18-26/h12-14,17-18,20,22,24-25,28H,4-11,15-16,19,21,23H2,1-3H3/t25-,28-/m1/s1 |
| InChIKey | ZKQKGBXNZWQPEY-LEAFIULHSA-N |
| XLogP | 9.14 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.69 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|