C14H22S — CID 140974651
2,2,4,4,7-pentamethyl-4a,5-dihydro-3H-thiochromene (PubChem CID 140974651) has the molecular formula C14H22S and a molecular weight of 222.40 g/mol. Its IUPAC name is 2,2,4,4,7-pentamethyl-4a,5-dihydro-3H-thiochromene.
| Compound Name | 2,2,4,4,7-pentamethyl-4a,5-dihydro-3H-thiochromene |
|---|---|
| PubChem CID | 140974651 |
| Molecular Formula | C14H22S |
| Molecular Weight | 222.40 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 2,2,4,4,7-pentamethyl-4a,5-dihydro-3H-thiochromene |
| SMILES | CC1=CCC2C(=C1)SC(C)(C)CC2(C)C |
| InChI | InChI=1S/C14H22S/c1-10-6-7-11-12(8-10)15-14(4,5)9-13(11,2)3/h6,8,11H,7,9H2,1-5H3 |
| InChIKey | KSPIUIBCKVOKJT-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |