About 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile
6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile (PubChem CID 137427519) has the molecular formula C8H10N2
and a molecular weight of 134.18 g/mol. Its IUPAC name is 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile.
Analyze 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile?
The IUPAC name of 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile (CID 137427519) is 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile.
What is the SMILES notation for 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile?
The canonical SMILES for 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile is CC1=CCC(N)C(C#N)=C1.
What is the InChIKey of 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile?
The InChIKey is OQAQTPDCIXNJJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2/c1-6-2-3-8(10)7(4-6)5-9/h2,4,8H,3,10H2,1H3.
What are the key properties of 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile?
6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile has a molecular weight of 134.18 g/mol, XLogP of 1.11, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-methylcyclohexa-1,3-diene-1-carbonitrile is sourced from PubChem (CID 137427519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).