C9H11NS2 — CID 166904306
6-methyl-2-sulfanyl-3-(sulfanylmethyl)cyclohexa-1,5-diene-1-carbonitrile (PubChem CID 166904306) has the molecular formula C9H11NS2 and a molecular weight of 197.33 g/mol. Its IUPAC name is 6-methyl-2-sulfanyl-3-(sulfanylmethyl)cyclohexa-1,5-diene-1-carbonitrile.
| Compound Name | 6-methyl-2-sulfanyl-3-(sulfanylmethyl)cyclohexa-1,5-diene-1-carbonitrile |
|---|---|
| PubChem CID | 166904306 |
| Molecular Formula | C9H11NS2 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 6-methyl-2-sulfanyl-3-(sulfanylmethyl)cyclohexa-1,5-diene-1-carbonitrile |
| SMILES | CC1=CCC(CS)C(S)=C1C#N |
| InChI | InChI=1S/C9H11NS2/c1-6-2-3-7(5-11)9(12)8(6)4-10/h2,7,11-12H,3,5H2,1H3 |
| InChIKey | MTRKFGSBSUXTEW-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|