C16N8 — CID 122363126
(1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2,3,4,5,6,7,8-octacarbonitrile (PubChem CID 122363126) has the molecular formula C16N8 and a molecular weight of 304.23 g/mol. Its IUPAC name is (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2,3,4,5,6,7,8-octacarbonitrile.
| Compound Name | (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2,3,4,5,6,7,8-octacarbonitrile |
|---|---|
| PubChem CID | 122363126 |
| Molecular Formula | C16N8 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (1Z,3Z,5Z,7Z)-cycloocta-1,3,5,7-tetraene-1,2,3,4,5,6,7,8-octacarbonitrile |
| SMILES | N#CC1=C(C#N)/C(C#N)=C(C#N)\C(C#N)=C(C#N)/C(C#N)=C\1C#N |
| InChI | InChI=1S/C16N8/c17-1-9-10(2-18)12(4-20)14(6-22)16(8-24)15(7-23)13(5-21)11(9)3-19/b10-9-,11-9-,12-10-,13-11-,14-12-,15-13-,16-14-,16-15- |
| InChIKey | GWGDBBVCZZRGGQ-NNXHHTRFSA-N |
| XLogP | 1.38 |
| TPSA | 190.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |