C7H3NO5 — CID 137146961
2,4,5-trihydroxy-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile (PubChem CID 137146961) has the molecular formula C7H3NO5 and a molecular weight of 181.10 g/mol. Its IUPAC name is 2,4,5-trihydroxy-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile.
| Compound Name | 2,4,5-trihydroxy-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile |
|---|---|
| PubChem CID | 137146961 |
| Molecular Formula | C7H3NO5 |
| Molecular Weight | 181.10 g/mol |
| Exact Mass | 181.00 |
| IUPAC Name | 2,4,5-trihydroxy-3,6-dioxocyclohexa-1,4-diene-1-carbonitrile |
| SMILES | N#CC1=C(O)C(=O)C(O)=C(O)C1=O |
| InChI | InChI=1S/C7H3NO5/c8-1-2-3(9)5(11)7(13)6(12)4(2)10/h9,12-13H |
| InChIKey | AKOWMVQTORCNSE-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.10 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|