C8H2N2O4 — CID 176537706
2-hydroxy-4-(iminomethylidene)-3,5,6-trioxocyclohexene-1-carbonitrile (PubChem CID 176537706) has the molecular formula C8H2N2O4 and a molecular weight of 190.11 g/mol. Its IUPAC name is 2-hydroxy-4-(iminomethylidene)-3,5,6-trioxocyclohexene-1-carbonitrile.
| Compound Name | 2-hydroxy-4-(iminomethylidene)-3,5,6-trioxocyclohexene-1-carbonitrile |
|---|---|
| PubChem CID | 176537706 |
| Molecular Formula | C8H2N2O4 |
| Molecular Weight | 190.11 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | 2-hydroxy-4-(iminomethylidene)-3,5,6-trioxocyclohexene-1-carbonitrile |
| SMILES | N#CC1=C(O)C(=O)C(=C=N)C(=O)C1=O |
| InChI | InChI=1S/C8H2N2O4/c9-1-3-5(11)7(13)4(2-10)8(14)6(3)12/h9,13H |
| InChIKey | RZLNYCNGAJLHRM-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.11 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|