About 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole
2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole (PubChem CID 153004103) has the molecular formula C9H13NS
and a molecular weight of 167.28 g/mol. Its IUPAC name is 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole.
Analyze 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole?
The IUPAC name of 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole (CID 153004103) is 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole.
What is the SMILES notation for 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole?
The canonical SMILES for 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole is CC1=CCC2NC(C)SC2=C1.
What is the InChIKey of 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole?
The InChIKey is UYSSBSQBPPPWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NS/c1-6-3-4-8-9(5-6)11-7(2)10-8/h3,5,7-8,10H,4H2,1-2H3.
What are the key properties of 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole?
2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole has a molecular weight of 167.28 g/mol, XLogP of 2.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2,3,3a,4-tetrahydro-1,3-benzothiazole is sourced from PubChem (CID 153004103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).