C10H16INS — CID 157143582
iodoethane;2-methyl-2,3,3a,4-tetrahydro-1,3-benzothiazole (PubChem CID 157143582) has the molecular formula C10H16INS and a molecular weight of 309.22 g/mol. Its IUPAC name is iodoethane;2-methyl-2,3,3a,4-tetrahydro-1,3-benzothiazole.
| Compound Name | iodoethane;2-methyl-2,3,3a,4-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 157143582 |
| Molecular Formula | C10H16INS |
| Molecular Weight | 309.22 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | iodoethane;2-methyl-2,3,3a,4-tetrahydro-1,3-benzothiazole |
| SMILES | CC1NC2CC=CC=C2S1.CCI |
| InChI | InChI=1S/C8H11NS.C2H5I/c1-6-9-7-4-2-3-5-8(7)10-6;1-2-3/h2-3,5-7,9H,4H2,1H3;2H2,1H3 |
| InChIKey | AKLNITWRDKZTBQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|