C10H12N2O7S — CID 140975499
1-[(1R,2S,4R,5R)-4-(hydroxymethyl)-2-methylsulfonyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione (PubChem CID 140975499) has the molecular formula C10H12N2O7S and a molecular weight of 304.28 g/mol. Its IUPAC name is 1-[(1R,2S,4R,5R)-4-(hydroxymethyl)-2-methylsulfonyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(1R,2S,4R,5R)-4-(hydroxymethyl)-2-methylsulfonyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 140975499 |
| Molecular Formula | C10H12N2O7S |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | 1-[(1R,2S,4R,5R)-4-(hydroxymethyl)-2-methylsulfonyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]pyrimidine-2,4-dione |
| SMILES | CS(=O)(=O)[C@@]1(n2ccc(=O)[nH]c2=O)O[C@H](CO)[C@H]2O[C@H]21 |
| InChI | InChI=1S/C10H12N2O7S/c1-20(16,17)10(8-7(18-8)5(4-13)19-10)12-3-2-6(14)11-9(12)15/h2-3,5,7-8,13H,4H2,1H3,(H,11,14,15)/t5-,7-,8-,10+/m1/s1 |
| InChIKey | PEIVNHYAQBGNQX-UZRKRJFESA-N |
| XLogP | -2.65 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|