About 1-(furan-2-yl)propyl prop-2-enoate
1-(furan-2-yl)propyl prop-2-enoate (PubChem CID 140979889) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 1-(furan-2-yl)propyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-(furan-2-yl)propyl prop-2-enoate |
| PubChem CID | 140979889 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1-(furan-2-yl)propyl prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)c1ccco1 |
| InChI | InChI=1S/C10H12O3/c1-3-8(13-10(11)4-2)9-6-5-7-12-9/h4-8H,2-3H2,1H3 |
| InChIKey | DCFOJVQQCXPPBW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(furan-2-yl)propyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(furan-2-yl)propyl prop-2-enoate?
The IUPAC name of 1-(furan-2-yl)propyl prop-2-enoate (CID 140979889) is 1-(furan-2-yl)propyl prop-2-enoate.
What is the SMILES notation for 1-(furan-2-yl)propyl prop-2-enoate?
The canonical SMILES for 1-(furan-2-yl)propyl prop-2-enoate is C=CC(=O)OC(CC)c1ccco1.
What is the InChIKey of 1-(furan-2-yl)propyl prop-2-enoate?
The InChIKey is DCFOJVQQCXPPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-3-8(13-10(11)4-2)9-6-5-7-12-9/h4-8H,2-3H2,1H3.
What are the key properties of 1-(furan-2-yl)propyl prop-2-enoate?
1-(furan-2-yl)propyl prop-2-enoate has a molecular weight of 180.20 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(furan-2-yl)propyl prop-2-enoate is sourced from PubChem (CID 140979889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).