C9H10N2O2 — CID 140981095
2-[6-(methylamino)-3-pyridinyl]prop-2-enoic acid (PubChem CID 140981095) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-[6-(methylamino)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | 2-[6-(methylamino)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 140981095 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 2-[6-(methylamino)-3-pyridinyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(NC)nc1 |
| InChI | InChI=1S/C9H10N2O2/c1-6(9(12)13)7-3-4-8(10-2)11-5-7/h3-5H,1H2,2H3,(H,10,11)(H,12,13) |
| InChIKey | SUFWUCDGTLHKQW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|