C12H15N5O — CID 140983077
N-[(6-carbamimidoyl-3-pyridinyl)methyl]-3,4-dihydro-2H-pyrrole-3-carboxamide (PubChem CID 140983077) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is N-[(6-carbamimidoyl-3-pyridinyl)methyl]-3,4-dihydro-2H-pyrrole-3-carboxamide.
| Compound Name | N-[(6-carbamimidoyl-3-pyridinyl)methyl]-3,4-dihydro-2H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 140983077 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | N-[(6-carbamimidoyl-3-pyridinyl)methyl]-3,4-dihydro-2H-pyrrole-3-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CC=NC2)cn1 |
| InChI | InChI=1S/C12H15N5O/c13-11(14)10-2-1-8(5-16-10)6-17-12(18)9-3-4-15-7-9/h1-2,4-5,9H,3,6-7H2,(H3,13,14)(H,17,18) |
| InChIKey | HSKFDDBBDHSLSJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|