C20H25N5O2 — CID 153287193
(3S)-N'-[(6-carbamimidoyl-3-pyridinyl)methyl]-3-methyl-2-(2-phenylethyl)butanediamide (PubChem CID 153287193) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3S)-N'-[(6-carbamimidoyl-3-pyridinyl)methyl]-3-methyl-2-(2-phenylethyl)butanediamide.
| Compound Name | (3S)-N'-[(6-carbamimidoyl-3-pyridinyl)methyl]-3-methyl-2-(2-phenylethyl)butanediamide |
|---|---|
| PubChem CID | 153287193 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | (3S)-N'-[(6-carbamimidoyl-3-pyridinyl)methyl]-3-methyl-2-(2-phenylethyl)butanediamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](C)C(CCc2ccccc2)C(N)=O)cn1 |
| InChI | InChI=1S/C20H25N5O2/c1-13(16(19(23)26)9-7-14-5-3-2-4-6-14)20(27)25-12-15-8-10-17(18(21)22)24-11-15/h2-6,8,10-11,13,16H,7,9,12H2,1H3,(H3,21,22)(H2,23,26)(H,25,27)/t13-,16?/m0/s1 |
| InChIKey | BBBORDCSXAKVOH-KNVGNIICSA-N |
| XLogP | 1.35 |
| TPSA | 134.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|