C14H11F2NO — CID 140984238
(NE)-N-[2-(3,4-difluorophenyl)-2-phenylethylidene]hydroxylamine (PubChem CID 140984238) has the molecular formula C14H11F2NO and a molecular weight of 247.24 g/mol. Its IUPAC name is (NE)-N-[2-(3,4-difluorophenyl)-2-phenylethylidene]hydroxylamine.
| Compound Name | (NE)-N-[2-(3,4-difluorophenyl)-2-phenylethylidene]hydroxylamine |
|---|---|
| PubChem CID | 140984238 |
| Molecular Formula | C14H11F2NO |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (NE)-N-[2-(3,4-difluorophenyl)-2-phenylethylidene]hydroxylamine |
| SMILES | O/N=C/C(c1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H11F2NO/c15-13-7-6-11(8-14(13)16)12(9-17-18)10-4-2-1-3-5-10/h1-9,12,18H/b17-9+ |
| InChIKey | GRHTWRNSRXEYDI-RQZCQDPDSA-N |
| XLogP | 3.56 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|