C12H21N5O3 — CID 140985245
(2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-propyl-3,4-dihydro-2H-pyran-2-carboxamide (PubChem CID 140985245) has the molecular formula C12H21N5O3 and a molecular weight of 283.33 g/mol. Its IUPAC name is (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-propyl-3,4-dihydro-2H-pyran-2-carboxamide.
| Compound Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-propyl-3,4-dihydro-2H-pyran-2-carboxamide |
|---|---|
| PubChem CID | 140985245 |
| Molecular Formula | C12H21N5O3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (2R,3R,4S)-3-acetamido-4-(diaminomethylideneamino)-N-propyl-3,4-dihydro-2H-pyran-2-carboxamide |
| SMILES | CCCNC(=O)[C@@H]1OC=C[C@H](N=C(N)N)[C@H]1NC(C)=O |
| InChI | InChI=1S/C12H21N5O3/c1-3-5-15-11(19)10-9(16-7(2)18)8(4-6-20-10)17-12(13)14/h4,6,8-10H,3,5H2,1-2H3,(H,15,19)(H,16,18)(H4,13,14,17)/t8-,9+,10+/m0/s1 |
| InChIKey | KYHWDXPEVIJUER-IVZWLZJFSA-N |
| XLogP | -1.43 |
| TPSA | 131.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|