C15H10N2O2S — CID 140986058
5-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-yl-1,3-oxazole (PubChem CID 140986058) has the molecular formula C15H10N2O2S and a molecular weight of 282.32 g/mol. Its IUPAC name is 5-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-yl-1,3-oxazole.
| Compound Name | 5-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-yl-1,3-oxazole |
|---|---|
| PubChem CID | 140986058 |
| Molecular Formula | C15H10N2O2S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 5-(furan-2-yl)-2-(1H-pyrrol-2-yl)-4-thiophen-2-yl-1,3-oxazole |
| SMILES | c1c[nH]c(-c2nc(-c3cccs3)c(-c3ccco3)o2)c1 |
| InChI | InChI=1S/C15H10N2O2S/c1-4-10(16-7-1)15-17-13(12-6-3-9-20-12)14(19-15)11-5-2-8-18-11/h1-9,16H |
| InChIKey | GQQPSITYCRCLDS-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |