About 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran
2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran (PubChem CID 161472206) has the molecular formula C15H11NO3S
and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran |
| PubChem CID | 161472206 |
| Molecular Formula | C15H11NO3S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran |
| SMILES | c1coc(-c2cccs2)c1.c1coc(-c2ncco2)c1 |
| InChI | InChI=1S/C8H6OS.C7H5NO2/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-6(9-4-1)7-8-3-5-10-7/h1-6H;1-5H |
| InChIKey | WDFXKFVMOKCFSO-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran?
The IUPAC name of 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran (CID 161472206) is 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran.
What is the SMILES notation for 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran?
The canonical SMILES for 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran is c1coc(-c2cccs2)c1.c1coc(-c2ncco2)c1.
What is the InChIKey of 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran?
The InChIKey is WDFXKFVMOKCFSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6OS.C7H5NO2/c1-3-7(9-5-1)8-4-2-6-10-8;1-2-6(9-4-1)7-8-3-5-10-7/h1-6H;1-5H.
What are the key properties of 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran?
2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran has a molecular weight of 285.32 g/mol, XLogP of 4.94, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-1,3-oxazole;2-thiophen-2-ylfuran is sourced from PubChem (CID 161472206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).